About 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one
6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one (PubChem CID 677722) has the molecular formula C14H16N2O2S
and a molecular weight of 276.36 g/mol. Its IUPAC name is 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one |
| PubChem CID | 677722 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(C(=O)N3CCCCC3)cc2N1 |
| InChI | InChI=1S/C14H16N2O2S/c17-13-9-19-12-5-4-10(8-11(12)15-13)14(18)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9H2,(H,15,17) |
| InChIKey | BAHRAIDGRVCZJN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one?
The IUPAC name of 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one (CID 677722) is 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one is O=C1CSc2ccc(C(=O)N3CCCCC3)cc2N1.
What is the InChIKey of 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one?
The InChIKey is BAHRAIDGRVCZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c17-13-9-19-12-5-4-10(8-11(12)15-13)14(18)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9H2,(H,15,17).
What are the key properties of 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one?
6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one has a molecular weight of 276.36 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(piperidine-1-carbonyl)-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 677722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).