C14H22N2O5 — CID 67772367
(2S)-2-[[(E,3S)-6-methoxy-6-oxohex-4-en-3-yl]carbamoyl]piperidine-1-carboxylic acid (PubChem CID 67772367) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S)-2-[[(E,3S)-6-methoxy-6-oxohex-4-en-3-yl]carbamoyl]piperidine-1-carboxylic acid.
| Compound Name | (2S)-2-[[(E,3S)-6-methoxy-6-oxohex-4-en-3-yl]carbamoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67772367 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2S)-2-[[(E,3S)-6-methoxy-6-oxohex-4-en-3-yl]carbamoyl]piperidine-1-carboxylic acid |
| SMILES | CC[C@@H](/C=C/C(=O)OC)NC(=O)[C@@H]1CCCCN1C(=O)O |
| InChI | InChI=1S/C14H22N2O5/c1-3-10(7-8-12(17)21-2)15-13(18)11-6-4-5-9-16(11)14(19)20/h7-8,10-11H,3-6,9H2,1-2H3,(H,15,18)(H,19,20)/b8-7+/t10-,11-/m0/s1 |
| InChIKey | LQZHXFVQSHIBKZ-IJUHFESZSA-N |
| XLogP | 1.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|