About (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine
(2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine (PubChem CID 67772533) has the molecular formula C11H22F2N2
and a molecular weight of 220.31 g/mol. Its IUPAC name is (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine |
| PubChem CID | 67772533 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine |
| SMILES | CN[C@H](CN1CCCC(F)(F)C1)C(C)C |
| InChI | InChI=1S/C11H22F2N2/c1-9(2)10(14-3)7-15-6-4-5-11(12,13)8-15/h9-10,14H,4-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | IWNPTNMLBDOULJ-SNVBAGLBSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine?
The IUPAC name of (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine (CID 67772533) is (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine.
What is the SMILES notation for (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine?
The canonical SMILES for (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine is CN[C@H](CN1CCCC(F)(F)C1)C(C)C.
What is the InChIKey of (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine?
The InChIKey is IWNPTNMLBDOULJ-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H22F2N2/c1-9(2)10(14-3)7-15-6-4-5-11(12,13)8-15/h9-10,14H,4-8H2,1-3H3/t10-/m1/s1.
What are the key properties of (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine?
(2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine has a molecular weight of 220.31 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(3,3-difluoropiperidin-1-yl)-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 67772533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).