C22H26N4O2 — CID 67772820
[(1S,2R)-2-[4-cyano-3-(3,5-dimethylanilino)anilino]cyclohexyl]carbamic acid (PubChem CID 67772820) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is [(1S,2R)-2-[4-cyano-3-(3,5-dimethylanilino)anilino]cyclohexyl]carbamic acid.
| Compound Name | [(1S,2R)-2-[4-cyano-3-(3,5-dimethylanilino)anilino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 67772820 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | [(1S,2R)-2-[4-cyano-3-(3,5-dimethylanilino)anilino]cyclohexyl]carbamic acid |
| SMILES | Cc1cc(C)cc(Nc2cc(N[C@@H]3CCCC[C@@H]3NC(=O)O)ccc2C#N)c1 |
| InChI | InChI=1S/C22H26N4O2/c1-14-9-15(2)11-18(10-14)25-21-12-17(8-7-16(21)13-23)24-19-5-3-4-6-20(19)26-22(27)28/h7-12,19-20,24-26H,3-6H2,1-2H3,(H,27,28)/t19-,20+/m1/s1 |
| InChIKey | XBZTVKYUKXAXKT-UXHICEINSA-N |
| XLogP | 4.91 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |