C26H32F3N3O4S — CID 67773469
(2S)-2-amino-N-[(E,4S)-1-(1,3-dihydroisoindol-2-yl)-6,6-dimethyl-1-oxohept-2-en-4-yl]-3-thiophen-2-ylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 67773469) has the molecular formula C26H32F3N3O4S and a molecular weight of 539.62 g/mol. Its IUPAC name is (2S)-2-amino-N-[(E,4S)-1-(1,3-dihydroisoindol-2-yl)-6,6-dimethyl-1-oxohept-2-en-4-yl]-3-thiophen-2-ylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-N-[(E,4S)-1-(1,3-dihydroisoindol-2-yl)-6,6-dimethyl-1-oxohept-2-en-4-yl]-3-thiophen-2-ylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67773469 |
| Molecular Formula | C26H32F3N3O4S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (2S)-2-amino-N-[(E,4S)-1-(1,3-dihydroisoindol-2-yl)-6,6-dimethyl-1-oxohept-2-en-4-yl]-3-thiophen-2-ylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)C[C@@H](/C=C/C(=O)N1Cc2ccccc2C1)NC(=O)[C@@H](N)Cc1cccs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H31N3O2S.C2HF3O2/c1-24(2,3)14-19(26-23(29)21(25)13-20-9-6-12-30-20)10-11-22(28)27-15-17-7-4-5-8-18(17)16-27;3-2(4,5)1(6)7/h4-12,19,21H,13-16,25H2,1-3H3,(H,26,29);(H,6,7)/b11-10+;/t19-,21+;/m1./s1 |
| InChIKey | RVQLJFNUGDJHLC-QNCHYYTOSA-N |
| XLogP | 4.27 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|