C30H41N7O3 — CID 67773746
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol (PubChem CID 67773746) has the molecular formula C30H41N7O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67773746 |
| Molecular Formula | C30H41N7O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol |
| SMILES | CCN(C[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(CCc2nc3ccc(C(C)(C)C)cc3[nH]2)C1 |
| InChI | InChI=1S/C30H41N7O3/c1-5-36(15-23-25(38)26(39)29(40-23)37-11-10-20-27(31)32-16-33-28(20)37)19-12-17(13-19)6-9-24-34-21-8-7-18(30(2,3)4)14-22(21)35-24/h7-8,10-11,14,16-17,19,23,25-26,29,38-39H,5-6,9,12-13,15H2,1-4H3,(H,34,35)(H2,31,32,33)/t17?,19?,23-,25-,26-,29-/m1/s1 |
| InChIKey | MFWUXFMWDRNICO-RCSHBCCJSA-N |
| XLogP | 3.54 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |