C18H23NO5 — CID 67773777
(3R)-1-[[7-(methoxymethoxy)-2H-chromen-3-yl]methyl]piperidine-3-carboxylic acid (PubChem CID 67773777) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3R)-1-[[7-(methoxymethoxy)-2H-chromen-3-yl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[[7-(methoxymethoxy)-2H-chromen-3-yl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67773777 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3R)-1-[[7-(methoxymethoxy)-2H-chromen-3-yl]methyl]piperidine-3-carboxylic acid |
| SMILES | COCOc1ccc2c(c1)OCC(CN1CCC[C@@H](C(=O)O)C1)=C2 |
| InChI | InChI=1S/C18H23NO5/c1-22-12-24-16-5-4-14-7-13(11-23-17(14)8-16)9-19-6-2-3-15(10-19)18(20)21/h4-5,7-8,15H,2-3,6,9-12H2,1H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | WJRHEKJVSSJZBT-OAHLLOKOSA-N |
| XLogP | 2.24 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|