C23H26FN5O2S2 — CID 67773961
(4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-6-methylhept-2-enamide (PubChem CID 67773961) has the molecular formula C23H26FN5O2S2 and a molecular weight of 487.63 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-6-methylhept-2-enamide.
| Compound Name | (4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-6-methylhept-2-enamide |
|---|---|
| PubChem CID | 67773961 |
| Molecular Formula | C23H26FN5O2S2 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (4S)-4-[[(2S)-2-amino-3-thiophen-2-ylpropanoyl]amino]-N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-6-methylhept-2-enamide |
| SMILES | CC(C)C[C@@H](C=CC(=O)Nc1nnc(-c2ccc(F)cc2)s1)NC(=O)[C@@H](N)Cc1cccs1 |
| InChI | InChI=1S/C23H26FN5O2S2/c1-14(2)12-17(26-21(31)19(25)13-18-4-3-11-32-18)9-10-20(30)27-23-29-28-22(33-23)15-5-7-16(24)8-6-15/h3-11,14,17,19H,12-13,25H2,1-2H3,(H,26,31)(H,27,29,30)/t17-,19+/m1/s1 |
| InChIKey | FASUXEMXKMOFCR-MJGOQNOKSA-N |
| XLogP | 4.00 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|