C18H26F2N2O2 — CID 67774102
3-(difluoromethyl)-N-[(2S)-1-(3-hydroxyazetidin-1-yl)hexan-2-yl]-N-methylbenzamide (PubChem CID 67774102) has the molecular formula C18H26F2N2O2 and a molecular weight of 340.41 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-[(2S)-1-(3-hydroxyazetidin-1-yl)hexan-2-yl]-N-methylbenzamide.
| Compound Name | 3-(difluoromethyl)-N-[(2S)-1-(3-hydroxyazetidin-1-yl)hexan-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 67774102 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-(difluoromethyl)-N-[(2S)-1-(3-hydroxyazetidin-1-yl)hexan-2-yl]-N-methylbenzamide |
| SMILES | CCCC[C@@H](CN1CC(O)C1)N(C)C(=O)c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-3-4-8-15(10-22-11-16(23)12-22)21(2)18(24)14-7-5-6-13(9-14)17(19)20/h5-7,9,15-17,23H,3-4,8,10-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | NHJFXPCWYHBFPR-HNNXBMFYSA-N |
| XLogP | 2.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |