C22H19NO2 — CID 67774393
4-methyl-4,5,5-triphenyl-1,3-oxazolidin-2-one (PubChem CID 67774393) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-methyl-4,5,5-triphenyl-1,3-oxazolidin-2-one.
| Compound Name | 4-methyl-4,5,5-triphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67774393 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-methyl-4,5,5-triphenyl-1,3-oxazolidin-2-one |
| SMILES | CC1(c2ccccc2)NC(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO2/c1-21(17-11-5-2-6-12-17)22(25-20(24)23-21,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3,(H,23,24) |
| InChIKey | UCPMEXLVOUNOOL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |