C27H32F3N7O2 — CID 67774632
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[methyl-[3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol (PubChem CID 67774632) has the molecular formula C27H32F3N7O2 and a molecular weight of 543.59 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[methyl-[3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[methyl-[3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 67774632 |
| Molecular Formula | C27H32F3N7O2 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[methyl-[3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol |
| SMILES | CN(C[C@H]1C[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(CCc2nc3ccc(C(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C27H32F3N7O2/c1-36(12-15-10-21(24(39)23(15)38)37-7-6-18-25(31)32-13-33-26(18)37)17-8-14(9-17)2-5-22-34-19-4-3-16(27(28,29)30)11-20(19)35-22/h3-4,6-7,11,13-15,17,21,23-24,38-39H,2,5,8-10,12H2,1H3,(H,34,35)(H2,31,32,33)/t14?,15-,17?,21-,23-,24+/m1/s1 |
| InChIKey | XLJXOHVDUIVFOW-GRRQPPBXSA-N |
| XLogP | 3.53 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |