C29H40N6O6 — CID 67774708
ethyl 3-[3-[[(1R,2R,3S,4R)-4-[6-[(2,4-dimethoxyphenyl)methylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]methylamino]cyclobutyl]propanoate (PubChem CID 67774708) has the molecular formula C29H40N6O6 and a molecular weight of 568.68 g/mol. Its IUPAC name is ethyl 3-[3-[[(1R,2R,3S,4R)-4-[6-[(2,4-dimethoxyphenyl)methylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]methylamino]cyclobutyl]propanoate.
| Compound Name | ethyl 3-[3-[[(1R,2R,3S,4R)-4-[6-[(2,4-dimethoxyphenyl)methylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]methylamino]cyclobutyl]propanoate |
|---|---|
| PubChem CID | 67774708 |
| Molecular Formula | C29H40N6O6 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | ethyl 3-[3-[[(1R,2R,3S,4R)-4-[6-[(2,4-dimethoxyphenyl)methylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]methylamino]cyclobutyl]propanoate |
| SMILES | CCOC(=O)CCC1CC(NC[C@H]2C[C@@H](n3cnc4c(NCc5ccc(OC)cc5OC)ncnc43)[C@H](O)[C@@H]2O)C1 |
| InChI | InChI=1S/C29H40N6O6/c1-4-41-24(36)8-5-17-9-20(10-17)30-14-19-11-22(27(38)26(19)37)35-16-34-25-28(32-15-33-29(25)35)31-13-18-6-7-21(39-2)12-23(18)40-3/h6-7,12,15-17,19-20,22,26-27,30,37-38H,4-5,8-11,13-14H2,1-3H3,(H,31,32,33)/t17?,19-,20?,22-,26-,27+/m1/s1 |
| InChIKey | JDNCYFUGVAQFTI-ZMNBCHNMSA-N |
| XLogP | 2.45 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |