About (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid
(2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 67774880) has the molecular formula C11H8F3NO3
and a molecular weight of 259.18 g/mol. Its IUPAC name is (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 67774880 |
| Molecular Formula | C11H8F3NO3 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC(=O)N1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H8F3NO3/c12-6-3-5(4-7(13)10(6)14)15-8(11(17)18)1-2-9(15)16/h3-4,8H,1-2H2,(H,17,18)/t8-/m0/s1 |
| InChIKey | FJTPAQXSPPMOGM-QMMMGPOBSA-N |
| XLogP | 1.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid (CID 67774880) is (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid is O=C(O)[C@@H]1CCC(=O)N1c1cc(F)c(F)c(F)c1.
What is the InChIKey of (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid?
The InChIKey is FJTPAQXSPPMOGM-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H8F3NO3/c12-6-3-5(4-7(13)10(6)14)15-8(11(17)18)1-2-9(15)16/h3-4,8H,1-2H2,(H,17,18)/t8-/m0/s1.
What are the key properties of (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid?
(2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid has a molecular weight of 259.18 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-oxo-1-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 67774880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).