About 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol
1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol (PubChem CID 677752) has the molecular formula C12H15Cl2NO
and a molecular weight of 260.16 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol |
| PubChem CID | 677752 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol |
| SMILES | OC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H15Cl2NO/c13-11-2-1-9(7-12(11)14)8-15-5-3-10(16)4-6-15/h1-2,7,10,16H,3-6,8H2 |
| InChIKey | DLTQYEPAQCPKMU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol?
The IUPAC name of 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol (CID 677752) is 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol.
What is the SMILES notation for 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol?
The canonical SMILES for 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol is OC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol?
The InChIKey is DLTQYEPAQCPKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO/c13-11-2-1-9(7-12(11)14)8-15-5-3-10(16)4-6-15/h1-2,7,10,16H,3-6,8H2.
What are the key properties of 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol?
1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol has a molecular weight of 260.16 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol is sourced from PubChem (CID 677752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).