C25H27ClF3N7O2 — CID 67775393
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol (PubChem CID 67775393) has the molecular formula C25H27ClF3N7O2 and a molecular weight of 549.99 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 67775393 |
| Molecular Formula | C25H27ClF3N7O2 |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol |
| SMILES | CN(C[C@H]1C[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(c2nc3cc(Cl)c(C(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C25H27ClF3N7O2/c1-35(9-12-6-19(21(38)20(12)37)36-3-2-14-22(30)31-10-32-24(14)36)13-4-11(5-13)23-33-17-7-15(25(27,28)29)16(26)8-18(17)34-23/h2-3,7-8,10-13,19-21,37-38H,4-6,9H2,1H3,(H,33,34)(H2,30,31,32)/t11?,12-,13?,19-,20-,21+/m1/s1 |
| InChIKey | VTATZTWDYXBGSJ-SNCDATCWSA-N |
| XLogP | 3.72 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |