C27H34F3N7O2 — CID 67775750
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol (PubChem CID 67775750) has the molecular formula C27H34F3N7O2 and a molecular weight of 545.61 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 67775750 |
| Molecular Formula | C27H34F3N7O2 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[propan-2-yl-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]butyl]amino]methyl]cyclopentane-1,2-diol |
| SMILES | CC(C)N(CCCCc1nc2ccc(C(F)(F)F)cc2[nH]1)C[C@H]1C[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H34F3N7O2/c1-15(2)36(9-4-3-5-22-34-19-7-6-17(27(28,29)30)12-20(19)35-22)13-16-11-21(24(39)23(16)38)37-10-8-18-25(31)32-14-33-26(18)37/h6-8,10,12,14-16,21,23-24,38-39H,3-5,9,11,13H2,1-2H3,(H,34,35)(H2,31,32,33)/t16-,21-,23-,24+/m1/s1 |
| InChIKey | MLHBCHNGQQYYGG-LNDODUDPSA-N |
| XLogP | 3.92 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|