About 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate
2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate (PubChem CID 67775904) has the molecular formula C16H14ClF3N2O2
and a molecular weight of 358.75 g/mol. Its IUPAC name is 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate.
Molecular Properties
| Compound Name | 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate |
| PubChem CID | 67775904 |
| Molecular Formula | C16H14ClF3N2O2 |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate |
| SMILES | [H]/N=C(\N)OCCc1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H14ClF3N2O2/c17-14-6-5-12(9-13(14)16(18,19)20)24-11-3-1-10(2-4-11)7-8-23-15(21)22/h1-6,9H,7-8H2,(H3,21,22) |
| InChIKey | SNBIEAOOVLXEDG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate?
The IUPAC name of 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate (CID 67775904) is 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate.
What is the SMILES notation for 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate?
The canonical SMILES for 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate is [H]/N=C(\N)OCCc1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1.
What is the InChIKey of 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate?
The InChIKey is SNBIEAOOVLXEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClF3N2O2/c17-14-6-5-12(9-13(14)16(18,19)20)24-11-3-1-10(2-4-11)7-8-23-15(21)22/h1-6,9H,7-8H2,(H3,21,22).
What are the key properties of 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate?
2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate has a molecular weight of 358.75 g/mol, XLogP of 4.60, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl carbamimidate is sourced from PubChem (CID 67775904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).