C29H39N7O3 — CID 67776206
(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]oxolane-3,4-diol (PubChem CID 67776206) has the molecular formula C29H39N7O3 and a molecular weight of 533.68 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67776206 |
| Molecular Formula | C29H39N7O3 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]oxolane-3,4-diol |
| SMILES | CN(C[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(CCc2nc3ccc(C(C)(C)C)cc3[nH]2)C1 |
| InChI | InChI=1S/C29H39N7O3/c1-29(2,3)17-6-7-20-21(13-17)34-23(33-20)8-5-16-11-18(12-16)35(4)14-22-24(37)25(38)28(39-22)36-10-9-19-26(30)31-15-32-27(19)36/h6-7,9-10,13,15-16,18,22,24-25,28,37-38H,5,8,11-12,14H2,1-4H3,(H,33,34)(H2,30,31,32)/t16?,18?,22-,24-,25-,28-/m1/s1 |
| InChIKey | PFBZYKCFFFLBMR-OHOTXUPZSA-N |
| XLogP | 3.15 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |