C27H33F3N8O4 — CID 67776587
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[propan-2-yl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol (PubChem CID 67776587) has the molecular formula C27H33F3N8O4 and a molecular weight of 590.61 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[propan-2-yl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[propan-2-yl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67776587 |
| Molecular Formula | C27H33F3N8O4 |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[propan-2-yl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol |
| SMILES | CC(C)N(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(CCc2nc3ccc(OC(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C27H33F3N8O4/c1-13(2)37(10-19-22(39)23(40)26(41-19)38-12-34-21-24(31)32-11-33-25(21)38)15-7-14(8-15)3-6-20-35-17-5-4-16(9-18(17)36-20)42-27(28,29)30/h4-5,9,11-15,19,22-23,26,39-40H,3,6-8,10H2,1-2H3,(H,35,36)(H2,31,32,33)/t14?,15?,19-,22-,23-,26-/m1/s1 |
| InChIKey | PPYSVTPOORSAIT-UMXJNFSWSA-N |
| XLogP | 2.92 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |