C27H33F3N8O4 — CID 67776732
(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[1-propan-2-yl-3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol (PubChem CID 67776732) has the molecular formula C27H33F3N8O4 and a molecular weight of 590.61 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[1-propan-2-yl-3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[1-propan-2-yl-3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67776732 |
| Molecular Formula | C27H33F3N8O4 |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[1-propan-2-yl-3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol |
| SMILES | CC(C)C1(NC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](O)[C@H]2O)CC(CCc2nc3ccc(OC(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C27H33F3N8O4/c1-13(2)26(8-14(9-26)3-6-19-36-16-5-4-15(7-17(16)37-19)42-27(28,29)30)35-10-18-21(39)22(40)25(41-18)38-12-34-20-23(31)32-11-33-24(20)38/h4-5,7,11-14,18,21-22,25,35,39-40H,3,6,8-10H2,1-2H3,(H,36,37)(H2,31,32,33)/t14?,18-,21+,22+,25-,26?/m1/s1 |
| InChIKey | BZNXILKLBNEYRD-NXISQTOBSA-N |
| XLogP | 2.83 |
| TPSA | 169.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |