C25H29F3N8O4 — CID 67776859
(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[methyl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol (PubChem CID 67776859) has the molecular formula C25H29F3N8O4 and a molecular weight of 562.55 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[methyl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[methyl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67776859 |
| Molecular Formula | C25H29F3N8O4 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[[methyl-[3-[2-[6-(trifluoromethoxy)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]oxolane-3,4-diol |
| SMILES | CN(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H](O)[C@H]1O)C1CC(CCc2nc3ccc(OC(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C25H29F3N8O4/c1-35(9-17-20(37)21(38)24(39-17)36-11-32-19-22(29)30-10-31-23(19)36)13-6-12(7-13)2-5-18-33-15-4-3-14(8-16(15)34-18)40-25(26,27)28/h3-4,8,10-13,17,20-21,24,37-38H,2,5-7,9H2,1H3,(H,33,34)(H2,29,30,31)/t12?,13?,17-,20+,21+,24-/m1/s1 |
| InChIKey | RTPSMISKNIYLHS-FLXAUNOBSA-N |
| XLogP | 2.15 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |