C33H39N5O5 — CID 67777531
5-methyl-2-[(1R)-2-(1-methylindol-3-yl)-1-[[4-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoylamino)pentanoyl]amino]ethyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 67777531) has the molecular formula C33H39N5O5 and a molecular weight of 585.71 g/mol. Its IUPAC name is 5-methyl-2-[(1R)-2-(1-methylindol-3-yl)-1-[[4-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoylamino)pentanoyl]amino]ethyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-methyl-2-[(1R)-2-(1-methylindol-3-yl)-1-[[4-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoylamino)pentanoyl]amino]ethyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67777531 |
| Molecular Formula | C33H39N5O5 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 5-methyl-2-[(1R)-2-(1-methylindol-3-yl)-1-[[4-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoylamino)pentanoyl]amino]ethyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1oc([C@@H](Cc2cn(C)c3ccccc23)NC(=O)C(CC(C)C)NC(=O)NC2CCCc3ccccc32)nc1C(=O)O |
| InChI | InChI=1S/C33H39N5O5/c1-19(2)16-26(36-33(42)35-25-14-9-11-21-10-5-6-12-23(21)25)30(39)34-27(31-37-29(32(40)41)20(3)43-31)17-22-18-38(4)28-15-8-7-13-24(22)28/h5-8,10,12-13,15,18-19,25-27H,9,11,14,16-17H2,1-4H3,(H,34,39)(H,40,41)(H2,35,36,42)/t25?,26?,27-/m1/s1 |
| InChIKey | LMXDEICEQNKLIC-WZDPVOGJSA-N |
| XLogP | 5.36 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |