C32H33FNO4P — CID 67777669
3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-ynyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid (PubChem CID 67777669) has the molecular formula C32H33FNO4P and a molecular weight of 545.59 g/mol. Its IUPAC name is 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-ynyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-ynyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 67777669 |
| Molecular Formula | C32H33FNO4P |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-fluorophenyl)but-1-ynyl]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(CC(C#Cc2ccc(CNCCCP(=O)(O)O)cc2-c2ccco2)c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C32H33FNO4P/c1-23-9-10-25(18-24(23)2)19-29(28-6-3-7-30(33)21-28)14-13-27-12-11-26(20-31(27)32-8-4-16-38-32)22-34-15-5-17-39(35,36)37/h3-4,6-12,16,18,20-21,29,34H,5,15,17,19,22H2,1-2H3,(H2,35,36,37) |
| InChIKey | HYVCMBKWDWJSGT-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|