C14H14N2 — CID 67778710
(1R,2R,3R,7R,8S,9S)-tetracyclo[7.2.1.02,8.03,7]dodec-10-ene-3,7-dicarbonitrile (PubChem CID 67778710) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (1R,2R,3R,7R,8S,9S)-tetracyclo[7.2.1.02,8.03,7]dodec-10-ene-3,7-dicarbonitrile.
| Compound Name | (1R,2R,3R,7R,8S,9S)-tetracyclo[7.2.1.02,8.03,7]dodec-10-ene-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 67778710 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (1R,2R,3R,7R,8S,9S)-tetracyclo[7.2.1.02,8.03,7]dodec-10-ene-3,7-dicarbonitrile |
| SMILES | N#C[C@@]12CCC[C@@]1(C#N)[C@H]1[C@@H]2[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H14N2/c15-7-13-4-1-5-14(13,8-16)12-10-3-2-9(6-10)11(12)13/h2-3,9-12H,1,4-6H2/t9-,10+,11+,12-,13-,14-/m1/s1 |
| InChIKey | LREDBVZWORFJHJ-GSZZWUTPSA-N |
| XLogP | 2.64 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|