C17H26O — CID 67779358
4-methoxy-6,6,7,7,8,8-hexamethyl-2H-naphthalene (PubChem CID 67779358) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 4-methoxy-6,6,7,7,8,8-hexamethyl-2H-naphthalene.
| Compound Name | 4-methoxy-6,6,7,7,8,8-hexamethyl-2H-naphthalene |
|---|---|
| PubChem CID | 67779358 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 4-methoxy-6,6,7,7,8,8-hexamethyl-2H-naphthalene |
| SMILES | COC1=CCC=C2C1=CC(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C17H26O/c1-15(2)11-12-13(9-8-10-14(12)18-7)16(3,4)17(15,5)6/h9-11H,8H2,1-7H3 |
| InChIKey | WGZZQXSYXAHVFA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |