C23H34N2O2 — CID 67780143
[(3aR,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]-ethylcarbamic acid (PubChem CID 67780143) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is [(3aR,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]-ethylcarbamic acid.
| Compound Name | [(3aR,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]-ethylcarbamic acid |
|---|---|
| PubChem CID | 67780143 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | [(3aR,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)c1cccc2c1CC[C@@H]1[C@H]2CCN1CCC1CCCCC1 |
| InChI | InChI=1S/C23H34N2O2/c1-2-25(23(26)27)22-10-6-9-18-19(22)11-12-21-20(18)14-16-24(21)15-13-17-7-4-3-5-8-17/h6,9-10,17,20-21H,2-5,7-8,11-16H2,1H3,(H,26,27)/t20-,21+/m0/s1 |
| InChIKey | LWTIMMGSHYBSGP-LEWJYISDSA-N |
| XLogP | 5.27 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |