C16H26O3 — CID 67780181
4-(cyclohexylmethyl)-2,2-dimethyl-5,7a-dihydro-3aH-1,3-benzodioxol-4-ol (PubChem CID 67780181) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-2,2-dimethyl-5,7a-dihydro-3aH-1,3-benzodioxol-4-ol.
| Compound Name | 4-(cyclohexylmethyl)-2,2-dimethyl-5,7a-dihydro-3aH-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 67780181 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4-(cyclohexylmethyl)-2,2-dimethyl-5,7a-dihydro-3aH-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)OC2C=CCC(O)(CC3CCCCC3)C2O1 |
| InChI | InChI=1S/C16H26O3/c1-15(2)18-13-9-6-10-16(17,14(13)19-15)11-12-7-4-3-5-8-12/h6,9,12-14,17H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | ITDPSHWGUHSQJS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|