C27H40ClN3O4 — CID 67780436
[(3aR,9bS)-3-[5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 67780436) has the molecular formula C27H40ClN3O4 and a molecular weight of 506.09 g/mol. Its IUPAC name is [(3aR,9bS)-3-[5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [(3aR,9bS)-3-[5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 67780436 |
| Molecular Formula | C27H40ClN3O4 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | [(3aR,9bS)-3-[5-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)Oc1cccc2c1CC[C@@H]1[C@H]2CCN1CCCCCN1C(=O)CC(C)(C)CC1=O.Cl |
| InChI | InChI=1S/C27H39N3O4.ClH/c1-27(2)17-24(31)30(25(32)18-27)15-7-5-6-14-29-16-13-20-19-9-8-10-23(34-26(33)28(3)4)21(19)11-12-22(20)29;/h8-10,20,22H,5-7,11-18H2,1-4H3;1H/t20-,22+;/m0./s1 |
| InChIKey | HOMPFXJZTKJQMF-IKGOIYPNSA-N |
| XLogP | 4.62 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|