About 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride
4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride (PubChem CID 67780509) has the molecular formula C8H10ClNO2S
and a molecular weight of 219.69 g/mol. Its IUPAC name is 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride |
| PubChem CID | 67780509 |
| Molecular Formula | C8H10ClNO2S |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride |
| SMILES | Cc1nc(C2CC2)c(C(=O)O)s1.Cl |
| InChI | InChI=1S/C8H9NO2S.ClH/c1-4-9-6(5-2-3-5)7(12-4)8(10)11;/h5H,2-3H2,1H3,(H,10,11);1H |
| InChIKey | OPYWOPXWEVXZDH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride?
The IUPAC name of 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride (CID 67780509) is 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride?
The canonical SMILES for 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride is Cc1nc(C2CC2)c(C(=O)O)s1.Cl.
What is the InChIKey of 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride?
The InChIKey is OPYWOPXWEVXZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S.ClH/c1-4-9-6(5-2-3-5)7(12-4)8(10)11;/h5H,2-3H2,1H3,(H,10,11);1H.
What are the key properties of 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride?
4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride has a molecular weight of 219.69 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 67780509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).