About 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide
2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide (PubChem CID 67780766) has the molecular formula C12H13O5P
and a molecular weight of 268.20 g/mol. Its IUPAC name is 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide.
Molecular Properties
| Compound Name | 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide |
| PubChem CID | 67780766 |
| Molecular Formula | C12H13O5P |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide |
| SMILES | CC1(COP2(=O)Oc3ccccc3O2)CC=CO1 |
| InChI | InChI=1S/C12H13O5P/c1-12(7-4-8-14-12)9-15-18(13)16-10-5-2-3-6-11(10)17-18/h2-6,8H,7,9H2,1H3 |
| InChIKey | ZHRLIKCQSNCFRX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide?
The IUPAC name of 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide (CID 67780766) is 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide.
What is the SMILES notation for 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide?
The canonical SMILES for 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide is CC1(COP2(=O)Oc3ccccc3O2)CC=CO1.
What is the InChIKey of 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide?
The InChIKey is ZHRLIKCQSNCFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13O5P/c1-12(7-4-8-14-12)9-15-18(13)16-10-5-2-3-6-11(10)17-18/h2-6,8H,7,9H2,1H3.
What are the key properties of 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide?
2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide has a molecular weight of 268.20 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-3H-furan-2-yl)methoxy]-1,3,2λ5-benzodioxaphosphole 2-oxide is sourced from PubChem (CID 67780766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).