C31H43N5O10 — CID 67780952
(4S)-9-[[2-(2,2-diethoxyethylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67780952) has the molecular formula C31H43N5O10 and a molecular weight of 645.71 g/mol. Its IUPAC name is (4S)-9-[[2-(2,2-diethoxyethylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S)-9-[[2-(2,2-diethoxyethylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67780952 |
| Molecular Formula | C31H43N5O10 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.30 |
| IUPAC Name | (4S)-9-[[2-(2,2-diethoxyethylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCOC(CNCC(=O)Nc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2)OCC |
| InChI | InChI=1S/C31H43N5O10/c1-7-45-20(46-8-2)13-33-12-19(37)34-17-11-18(35(3)4)15-9-14-10-16-24(36(5)6)27(40)23(30(32)43)29(42)31(16,44)28(41)21(14)26(39)22(15)25(17)38/h11,14,16,20,24,33,38-39,42,44H,7-10,12-13H2,1-6H3,(H2,32,43)(H,34,37)/t14?,16?,24-,31?/m0/s1 |
| InChIKey | QEXXMIPAYXJUOJ-ALQHLTCSSA-N |
| XLogP | -0.04 |
| TPSA | 224.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|