About methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride
methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride (PubChem CID 67780984) has the molecular formula C10H17ClN4O2
and a molecular weight of 260.72 g/mol. Its IUPAC name is methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride |
| PubChem CID | 67780984 |
| Molecular Formula | C10H17ClN4O2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)n1nc(C)c(CCC(=O)OC)c1C |
| InChI | InChI=1S/C10H16N4O2.ClH/c1-6-8(4-5-9(15)16-3)7(2)14(13-6)10(11)12;/h4-5H2,1-3H3,(H3,11,12);1H |
| InChIKey | IIZVEMWGXWDYKL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride?
The IUPAC name of methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride (CID 67780984) is methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride.
What is the SMILES notation for methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride?
The canonical SMILES for methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride is Cl.[H]/N=C(\N)n1nc(C)c(CCC(=O)OC)c1C.
What is the InChIKey of methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride?
The InChIKey is IIZVEMWGXWDYKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2.ClH/c1-6-8(4-5-9(15)16-3)7(2)14(13-6)10(11)12;/h4-5H2,1-3H3,(H3,11,12);1H.
What are the key properties of methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride?
methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride has a molecular weight of 260.72 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1-carbamimidoyl-3,5-dimethylpyrazol-4-yl)propanoate;hydrochloride is sourced from PubChem (CID 67780984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).