About 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one
1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one (PubChem CID 67781043) has the molecular formula C12H26N4O
and a molecular weight of 242.37 g/mol. Its IUPAC name is 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one |
| PubChem CID | 67781043 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one |
| SMILES | CC(C)(CN)N1CCCN(C(C)(C)CN)C1=O |
| InChI | InChI=1S/C12H26N4O/c1-11(2,8-13)15-6-5-7-16(10(15)17)12(3,4)9-14/h5-9,13-14H2,1-4H3 |
| InChIKey | ABBMYGRCBMJMSE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one?
The IUPAC name of 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one (CID 67781043) is 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one.
What is the SMILES notation for 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one?
The canonical SMILES for 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one is CC(C)(CN)N1CCCN(C(C)(C)CN)C1=O.
What is the InChIKey of 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one?
The InChIKey is ABBMYGRCBMJMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N4O/c1-11(2,8-13)15-6-5-7-16(10(15)17)12(3,4)9-14/h5-9,13-14H2,1-4H3.
What are the key properties of 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one?
1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one has a molecular weight of 242.37 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1-amino-2-methylpropan-2-yl)-1,3-diazinan-2-one is sourced from PubChem (CID 67781043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).