About 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride
2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride (PubChem CID 67781099) has the molecular formula C9H9Cl
and a molecular weight of 152.62 g/mol. Its IUPAC name is 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride.
Molecular Properties
| Compound Name | 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride |
| PubChem CID | 67781099 |
| Molecular Formula | C9H9Cl |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride |
| SMILES | C=Cc1ccc2cc1C2.Cl |
| InChI | InChI=1S/C9H8.ClH/c1-2-8-4-3-7-5-9(8)6-7;/h2-5H,1,6H2;1H |
| InChIKey | MTLABPOFVOREIQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride?
The IUPAC name of 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride (CID 67781099) is 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride.
What is the SMILES notation for 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride?
The canonical SMILES for 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride is C=Cc1ccc2cc1C2.Cl.
What is the InChIKey of 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride?
The InChIKey is MTLABPOFVOREIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.ClH/c1-2-8-4-3-7-5-9(8)6-7;/h2-5H,1,6H2;1H.
What are the key properties of 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride?
2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride has a molecular weight of 152.62 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylbicyclo[3.1.1]hepta-1,3,5-triene;hydrochloride is sourced from PubChem (CID 67781099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).