C35H39N5O5 — CID 67781190
N-[(3S,6S,7R)-1-amino-8-[2-(butylcarbamoyl)phenyl]-7-hydroxy-1,4-dioxo-6-(pyridin-3-ylmethyl)octan-3-yl]quinoline-2-carboxamide (PubChem CID 67781190) has the molecular formula C35H39N5O5 and a molecular weight of 609.73 g/mol. Its IUPAC name is N-[(3S,6S,7R)-1-amino-8-[2-(butylcarbamoyl)phenyl]-7-hydroxy-1,4-dioxo-6-(pyridin-3-ylmethyl)octan-3-yl]quinoline-2-carboxamide.
| Compound Name | N-[(3S,6S,7R)-1-amino-8-[2-(butylcarbamoyl)phenyl]-7-hydroxy-1,4-dioxo-6-(pyridin-3-ylmethyl)octan-3-yl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 67781190 |
| Molecular Formula | C35H39N5O5 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N-[(3S,6S,7R)-1-amino-8-[2-(butylcarbamoyl)phenyl]-7-hydroxy-1,4-dioxo-6-(pyridin-3-ylmethyl)octan-3-yl]quinoline-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccccc1C[C@@H](O)[C@H](CC(=O)[C@H](CC(N)=O)NC(=O)c1ccc2ccccc2n1)Cc1cccnc1 |
| InChI | InChI=1S/C35H39N5O5/c1-2-3-17-38-34(44)27-12-6-4-11-25(27)19-31(41)26(18-23-9-8-16-37-22-23)20-32(42)30(21-33(36)43)40-35(45)29-15-14-24-10-5-7-13-28(24)39-29/h4-16,22,26,30-31,41H,2-3,17-21H2,1H3,(H2,36,43)(H,38,44)(H,40,45)/t26-,30-,31+/m0/s1 |
| InChIKey | SIGLTVBEQFZILB-HOSFBAFGSA-N |
| XLogP | 3.56 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|