C15H22O4Si — CID 67781302
2-[2-(1-trimethylsilylethoxymethoxy)phenyl]prop-2-enoic acid (PubChem CID 67781302) has the molecular formula C15H22O4Si and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[2-(1-trimethylsilylethoxymethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 2-[2-(1-trimethylsilylethoxymethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67781302 |
| Molecular Formula | C15H22O4Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-[2-(1-trimethylsilylethoxymethoxy)phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccccc1OCOC(C)[Si](C)(C)C |
| InChI | InChI=1S/C15H22O4Si/c1-11(15(16)17)13-8-6-7-9-14(13)19-10-18-12(2)20(3,4)5/h6-9,12H,1,10H2,2-5H3,(H,16,17) |
| InChIKey | QGFZQIXOOQAXQJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|