About 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride
3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride (PubChem CID 67781596) has the molecular formula C6H13ClN4
and a molecular weight of 176.65 g/mol. Its IUPAC name is 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride.
Molecular Properties
| Compound Name | 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride |
| PubChem CID | 67781596 |
| Molecular Formula | C6H13ClN4 |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride |
| SMILES | CC1(N)C=C(N)C=NC1N.Cl |
| InChI | InChI=1S/C6H12N4.ClH/c1-6(9)2-4(7)3-10-5(6)8;/h2-3,5H,7-9H2,1H3;1H |
| InChIKey | TWNRWGQAXOYOIM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride?
The IUPAC name of 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride (CID 67781596) is 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride.
What is the SMILES notation for 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride?
The canonical SMILES for 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride is CC1(N)C=C(N)C=NC1N.Cl.
What is the InChIKey of 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride?
The InChIKey is TWNRWGQAXOYOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4.ClH/c1-6(9)2-4(7)3-10-5(6)8;/h2-3,5H,7-9H2,1H3;1H.
What are the key properties of 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride?
3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride has a molecular weight of 176.65 g/mol, XLogP of -0.66, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-pyridine-2,3,5-triamine;hydrochloride is sourced from PubChem (CID 67781596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).