C20H27IO2 — CID 67781632
(1R,2R,8R,9S,10S,13S,14S)-2-iodo-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 67781632) has the molecular formula C20H27IO2 and a molecular weight of 426.34 g/mol. Its IUPAC name is (1R,2R,8R,9S,10S,13S,14S)-2-iodo-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (1R,2R,8R,9S,10S,13S,14S)-2-iodo-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 67781632 |
| Molecular Formula | C20H27IO2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (1R,2R,8R,9S,10S,13S,14S)-2-iodo-1,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@H]1[C@@H](I)C(=O)C=C2CC[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@]21C |
| InChI | InChI=1S/C20H27IO2/c1-11-18(21)16(22)10-12-4-5-13-14-6-7-17(23)19(14,2)9-8-15(13)20(11,12)3/h10-11,13-15,18H,4-9H2,1-3H3/t11-,13-,14-,15-,18+,19-,20-/m0/s1 |
| InChIKey | JZNIOQGUFIUFLD-IOHGRTKUSA-N |
| XLogP | 4.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|