C20H25NO6Si — CID 67781700
2-oxo-2-[(3S,4R)-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid (PubChem CID 67781700) has the molecular formula C20H25NO6Si and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-oxo-2-[(3S,4R)-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid.
| Compound Name | 2-oxo-2-[(3S,4R)-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 67781700 |
| Molecular Formula | C20H25NO6Si |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-oxo-2-[(3S,4R)-2-oxo-4-[(2R)-1-oxo-3,4-dihydro-2H-naphthalen-2-yl]-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]acetic acid |
| SMILES | C[C@@H](O[Si](C)(C)C)[C@H]1C(=O)N(C(=O)C(=O)O)[C@@H]1[C@H]1CCc2ccccc2C1=O |
| InChI | InChI=1S/C20H25NO6Si/c1-11(27-28(2,3)4)15-16(21(18(15)23)19(24)20(25)26)14-10-9-12-7-5-6-8-13(12)17(14)22/h5-8,11,14-16H,9-10H2,1-4H3,(H,25,26)/t11-,14-,15-,16-/m1/s1 |
| InChIKey | FOECBPFHBQNQBK-RAEVTNRLSA-N |
| XLogP | 2.11 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|