About cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine
cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine (PubChem CID 67781833) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine |
| PubChem CID | 67781833 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine |
| SMILES | NCCN.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.C2H8N2/c7-5-1-2-6(8)4-3-5;3-1-2-4/h1-4H;1-4H2 |
| InChIKey | WEHGJIBEACNWRM-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine?
The IUPAC name of cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine (CID 67781833) is cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine?
The canonical SMILES for cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine is NCCN.O=C1C=CC(=O)C=C1.
What is the InChIKey of cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine?
The InChIKey is WEHGJIBEACNWRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C2H8N2/c7-5-1-2-6(8)4-3-5;3-1-2-4/h1-4H;1-4H2.
What are the key properties of cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine?
cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine has a molecular weight of 168.20 g/mol, XLogP of -0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-dione;ethane-1,2-diamine is sourced from PubChem (CID 67781833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).