About 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine
5-fluoro-2,4-di(piperidin-1-yl)pyrimidine (PubChem CID 677821) has the molecular formula C14H21FN4
and a molecular weight of 264.35 g/mol. Its IUPAC name is 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine |
| PubChem CID | 677821 |
| Molecular Formula | C14H21FN4 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine |
| SMILES | Fc1cnc(N2CCCCC2)nc1N1CCCCC1 |
| InChI | InChI=1S/C14H21FN4/c15-12-11-16-14(19-9-5-2-6-10-19)17-13(12)18-7-3-1-4-8-18/h11H,1-10H2 |
| InChIKey | VYPASFBYUHIMCW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine?
The IUPAC name of 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine (CID 677821) is 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine.
What is the SMILES notation for 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine?
The canonical SMILES for 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine is Fc1cnc(N2CCCCC2)nc1N1CCCCC1.
What is the InChIKey of 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine?
The InChIKey is VYPASFBYUHIMCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FN4/c15-12-11-16-14(19-9-5-2-6-10-19)17-13(12)18-7-3-1-4-8-18/h11H,1-10H2.
What are the key properties of 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine?
5-fluoro-2,4-di(piperidin-1-yl)pyrimidine has a molecular weight of 264.35 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4-di(piperidin-1-yl)pyrimidine is sourced from PubChem (CID 677821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).