About 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate
2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate (PubChem CID 67782322) has the molecular formula C25H46O4Si
and a molecular weight of 438.73 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate |
| PubChem CID | 67782322 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate |
| SMILES | CCCCC=C(C(=O)OCC[Si](C)(C)C)C1[C@H](O)CC[C@H]1C=CCCCCCCO |
| InChI | InChI=1S/C25H46O4Si/c1-5-6-11-15-22(25(28)29-19-20-30(2,3)4)24-21(16-17-23(24)27)14-12-9-7-8-10-13-18-26/h12,14-15,21,23-24,26-27H,5-11,13,16-20H2,1-4H3/t21-,23-,24?/m1/s1 |
| InChIKey | AVGPIWUJYJIEES-UMBAGBCYSA-N |
| XLogP | 5.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The IUPAC name of 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate (CID 67782322) is 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate.
What is the SMILES notation for 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The canonical SMILES for 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate is CCCCC=C(C(=O)OCC[Si](C)(C)C)C1[C@H](O)CC[C@H]1C=CCCCCCCO.
What is the InChIKey of 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
The InChIKey is AVGPIWUJYJIEES-UMBAGBCYSA-N. The full InChI is InChI=1S/C25H46O4Si/c1-5-6-11-15-22(25(28)29-19-20-30(2,3)4)24-21(16-17-23(24)27)14-12-9-7-8-10-13-18-26/h12,14-15,21,23-24,26-27H,5-11,13,16-20H2,1-4H3/t21-,23-,24?/m1/s1.
What are the key properties of 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate?
2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate has a molecular weight of 438.73 g/mol, XLogP of 5.87, 15 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-[(2R,5S)-2-hydroxy-5-(8-hydroxyoct-1-enyl)cyclopentyl]hept-2-enoate is sourced from PubChem (CID 67782322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).