About 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine
2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine (PubChem CID 67782760) has the molecular formula C18H26N4O4
and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine.
Molecular Properties
| Compound Name | 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine |
| PubChem CID | 67782760 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine |
| SMILES | NCCN.NCCNC(C(=O)O)(c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C16H18N2O4.C2H8N2/c17-9-10-18-16(15(21)22,11-5-1-3-7-13(11)19)12-6-2-4-8-14(12)20;3-1-2-4/h1-8,18-20H,9-10,17H2,(H,21,22);1-4H2 |
| InChIKey | DJRWOJUUYUJFKA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine?
The IUPAC name of 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine (CID 67782760) is 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine.
What is the SMILES notation for 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine?
The canonical SMILES for 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine is NCCN.NCCNC(C(=O)O)(c1ccccc1O)c1ccccc1O.
What is the InChIKey of 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine?
The InChIKey is DJRWOJUUYUJFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4.C2H8N2/c17-9-10-18-16(15(21)22,11-5-1-3-7-13(11)19)12-6-2-4-8-14(12)20;3-1-2-4/h1-8,18-20H,9-10,17H2,(H,21,22);1-4H2.
What are the key properties of 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine?
2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine has a molecular weight of 362.43 g/mol, XLogP of -0.12, 7 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethylamino)-2,2-bis(2-hydroxyphenyl)acetic acid;ethane-1,2-diamine is sourced from PubChem (CID 67782760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).