About pyrazolo[4,3-d]triazin-3-amine
pyrazolo[4,3-d]triazin-3-amine (PubChem CID 67783435) has the molecular formula C4H4N6
and a molecular weight of 136.12 g/mol. Its IUPAC name is pyrazolo[4,3-d]triazin-3-amine.
Molecular Properties
| Compound Name | pyrazolo[4,3-d]triazin-3-amine |
| PubChem CID | 67783435 |
| Molecular Formula | C4H4N6 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | pyrazolo[4,3-d]triazin-3-amine |
| SMILES | Nn1cc2nncc-2nn1 |
| InChI | InChI=1S/C4H4N6/c5-10-2-4-3(8-9-10)1-6-7-4/h1-2H,5H2 |
| InChIKey | PCELQPKFJDBIQW-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyrazolo[4,3-d]triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[4,3-d]triazin-3-amine?
The IUPAC name of pyrazolo[4,3-d]triazin-3-amine (CID 67783435) is pyrazolo[4,3-d]triazin-3-amine.
What is the SMILES notation for pyrazolo[4,3-d]triazin-3-amine?
The canonical SMILES for pyrazolo[4,3-d]triazin-3-amine is Nn1cc2nncc-2nn1.
What is the InChIKey of pyrazolo[4,3-d]triazin-3-amine?
The InChIKey is PCELQPKFJDBIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N6/c5-10-2-4-3(8-9-10)1-6-7-4/h1-2H,5H2.
What are the key properties of pyrazolo[4,3-d]triazin-3-amine?
pyrazolo[4,3-d]triazin-3-amine has a molecular weight of 136.12 g/mol, XLogP of -1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[4,3-d]triazin-3-amine is sourced from PubChem (CID 67783435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).