About 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole
4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole (PubChem CID 67783756) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole.
Molecular Properties
| Compound Name | 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole |
| PubChem CID | 67783756 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole |
| SMILES | CC1(C)C=CC=CC1c1cn[nH]n1 |
| InChI | InChI=1S/C10H13N3/c1-10(2)6-4-3-5-8(10)9-7-11-13-12-9/h3-8H,1-2H3,(H,11,12,13) |
| InChIKey | FEEWJLBXFDZKBM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole?
The IUPAC name of 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole (CID 67783756) is 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole.
What is the SMILES notation for 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole?
The canonical SMILES for 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole is CC1(C)C=CC=CC1c1cn[nH]n1.
What is the InChIKey of 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole?
The InChIKey is FEEWJLBXFDZKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-10(2)6-4-3-5-8(10)9-7-11-13-12-9/h3-8H,1-2H3,(H,11,12,13).
What are the key properties of 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole?
4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole has a molecular weight of 175.23 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-2H-triazole is sourced from PubChem (CID 67783756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).