About butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one
butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one (PubChem CID 67784181) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one |
| PubChem CID | 67784181 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one |
| SMILES | CC/C=C/CC1=C(C)CCC1=O.NCCCCN |
| InChI | InChI=1S/C11H16O.C4H12N2/c1-3-4-5-6-10-9(2)7-8-11(10)12;5-3-1-2-4-6/h4-5H,3,6-8H2,1-2H3;1-6H2/b5-4+; |
| InChIKey | FVIJUMFUIWYOIE-FXRZFVDSSA-N |
| XLogP | 2.71 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one?
The IUPAC name of butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one (CID 67784181) is butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one.
What is the SMILES notation for butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one?
The canonical SMILES for butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one is CC/C=C/CC1=C(C)CCC1=O.NCCCCN.
What is the InChIKey of butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one?
The InChIKey is FVIJUMFUIWYOIE-FXRZFVDSSA-N. The full InChI is InChI=1S/C11H16O.C4H12N2/c1-3-4-5-6-10-9(2)7-8-11(10)12;5-3-1-2-4-6/h4-5H,3,6-8H2,1-2H3;1-6H2/b5-4+;.
What are the key properties of butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one?
butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one has a molecular weight of 252.40 g/mol, XLogP of 2.71, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,4-diamine;3-methyl-2-[(E)-pent-2-enyl]cyclopent-2-en-1-one is sourced from PubChem (CID 67784181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).