About N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide
N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide (PubChem CID 67784331) has the molecular formula C18H21N3O4S
and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide |
| PubChem CID | 67784331 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide |
| SMILES | Cc1c(C#N)ccc2c1C(N1CCCC1=O)=C(NS(C)(=O)=O)C(C)(C)O2 |
| InChI | InChI=1S/C18H21N3O4S/c1-11-12(10-19)7-8-13-15(11)16(21-9-5-6-14(21)22)17(18(2,3)25-13)20-26(4,23)24/h7-8,20H,5-6,9H2,1-4H3 |
| InChIKey | RGPWWFWJJFAEPG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide?
The IUPAC name of N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide (CID 67784331) is N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide.
What is the SMILES notation for N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide?
The canonical SMILES for N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide is Cc1c(C#N)ccc2c1C(N1CCCC1=O)=C(NS(C)(=O)=O)C(C)(C)O2.
What is the InChIKey of N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide?
The InChIKey is RGPWWFWJJFAEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O4S/c1-11-12(10-19)7-8-13-15(11)16(21-9-5-6-14(21)22)17(18(2,3)25-13)20-26(4,23)24/h7-8,20H,5-6,9H2,1-4H3.
What are the key properties of N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide?
N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide has a molecular weight of 375.45 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-cyano-2,2,5-trimethyl-4-(2-oxopyrrolidin-1-yl)chromen-3-yl]methanesulfonamide is sourced from PubChem (CID 67784331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).