About (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol
(2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol (PubChem CID 67784418) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol.
Molecular Properties
| Compound Name | (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol |
| PubChem CID | 67784418 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol |
| SMILES | CC1(CO)COC(C)(C(C)(C)C)N1 |
| InChI | InChI=1S/C10H21NO2/c1-8(2,3)10(5)11-9(4,6-12)7-13-10/h11-12H,6-7H2,1-5H3 |
| InChIKey | NKEJKQUHBYEQFY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol?
The IUPAC name of (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol (CID 67784418) is (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol.
What is the SMILES notation for (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol?
The canonical SMILES for (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol is CC1(CO)COC(C)(C(C)(C)C)N1.
What is the InChIKey of (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol?
The InChIKey is NKEJKQUHBYEQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-8(2,3)10(5)11-9(4,6-12)7-13-10/h11-12H,6-7H2,1-5H3.
What are the key properties of (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol?
(2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol has a molecular weight of 187.28 g/mol, XLogP of 1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-2,4-dimethyl-1,3-oxazolidin-4-yl)methanol is sourced from PubChem (CID 67784418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).