About cyclohexa-3,5-diene-1,2-dione;iron
cyclohexa-3,5-diene-1,2-dione;iron (PubChem CID 67784673) has the molecular formula C6H4FeO2
and a molecular weight of 163.94 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-dione;iron.
Molecular Properties
| Compound Name | cyclohexa-3,5-diene-1,2-dione;iron |
| PubChem CID | 67784673 |
| Molecular Formula | C6H4FeO2 |
| Molecular Weight | 163.94 g/mol |
| Exact Mass | 163.96 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-dione;iron |
| SMILES | O=C1C=CC=CC1=O.[Fe] |
| InChI | InChI=1S/C6H4O2.Fe/c7-5-3-1-2-4-6(5)8;/h1-4H; |
| InChIKey | DWGUVJDIRHBTTJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.94 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-3,5-diene-1,2-dione;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-3,5-diene-1,2-dione;iron?
The IUPAC name of cyclohexa-3,5-diene-1,2-dione;iron (CID 67784673) is cyclohexa-3,5-diene-1,2-dione;iron.
What is the SMILES notation for cyclohexa-3,5-diene-1,2-dione;iron?
The canonical SMILES for cyclohexa-3,5-diene-1,2-dione;iron is O=C1C=CC=CC1=O.[Fe].
What is the InChIKey of cyclohexa-3,5-diene-1,2-dione;iron?
The InChIKey is DWGUVJDIRHBTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.Fe/c7-5-3-1-2-4-6(5)8;/h1-4H;.
What are the key properties of cyclohexa-3,5-diene-1,2-dione;iron?
cyclohexa-3,5-diene-1,2-dione;iron has a molecular weight of 163.94 g/mol, XLogP of 0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-3,5-diene-1,2-dione;iron is sourced from PubChem (CID 67784673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).