C15H12F3N3O3S — CID 67784693
ethyl (E)-3-[methyl(1,2,5-thiadiazol-3-yl)amino]-2-(2,4,5-trifluorobenzoyl)prop-2-enoate (PubChem CID 67784693) has the molecular formula C15H12F3N3O3S and a molecular weight of 371.34 g/mol. Its IUPAC name is ethyl (E)-3-[methyl(1,2,5-thiadiazol-3-yl)amino]-2-(2,4,5-trifluorobenzoyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[methyl(1,2,5-thiadiazol-3-yl)amino]-2-(2,4,5-trifluorobenzoyl)prop-2-enoate |
|---|---|
| PubChem CID | 67784693 |
| Molecular Formula | C15H12F3N3O3S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | ethyl (E)-3-[methyl(1,2,5-thiadiazol-3-yl)amino]-2-(2,4,5-trifluorobenzoyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/N(C)c1cnsn1)C(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H12F3N3O3S/c1-3-24-15(23)9(7-21(2)13-6-19-25-20-13)14(22)8-4-11(17)12(18)5-10(8)16/h4-7H,3H2,1-2H3/b9-7+ |
| InChIKey | SVKHGQRYSPZHSQ-VQHVLOKHSA-N |
| XLogP | 2.72 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|